CAS 110525-48-9

4-(2,5-dimethyl-1H-pyrrol-1-yl)butanoic acid

Description:

4-(2,5-Dimethyl-1H-pyrrol-1-yl)butanoic acid, with the CAS number 110525-48-9, is an organic compound characterized by its pyrrole ring structure and a butanoic acid functional group. This substance features a pyrrole moiety substituted with two methyl groups at the 2 and 5 positions, which contributes to its unique chemical properties. The presence of the butanoic acid group indicates that it has both acidic and hydrophobic characteristics, making it potentially useful in various chemical applications, including pharmaceuticals and agrochemicals. The compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group while maintaining some hydrophobic character from the alkyl substituents. Its molecular structure suggests potential for interactions such as hydrogen bonding, which can influence its reactivity and biological activity. Overall, this compound's unique structure may provide interesting avenues for research in medicinal chemistry and material science.

Formula: C₁₀H₁₅NO₂

InChI: InChI=1/C10H15NO2/c1-8-5-6-9(2)11(8)7-3-4-10(12)13/h5-6H,3-4,7H2,1-2H3,(H,12,13)