CAS 110525-55-8

Ethyl 1H-pyrazole-1-butanoate

Description:

Ethyl 1H-pyrazole-1-butanoate, with the CAS number 110525-55-8, is an organic compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its potential applications in medicinal chemistry and as a building block in the synthesis of various pharmaceuticals. The presence of the ethyl ester group contributes to its reactivity, making it suitable for further chemical modifications. Ethyl 1H-pyrazole-1-butanoate may exhibit biological activity, including anti-inflammatory or anti-cancer properties, although specific biological effects can vary based on the context of its use. As with many organic compounds, it is important to handle it with care, observing appropriate safety protocols to mitigate any risks associated with its chemical properties.

Formula: C₉H₁₄N₂O₂

InChI: InChI=1S/C9H14N2O2/c1-2-13-9(12)5-3-7-11-8-4-6-10-11/h4,6,8H,2-3,5,7H2,1H3

InChI key: InChIKey=FGGKUMKJPXBPNS-UHFFFAOYSA-N

SMILES: C(CCC(OCC)=O)N1C=CC=N1

Synonyms:

• 1H-Pyrazole-1-butanoic acid, ethyl ester
• Ethyl 1H-pyrazole-1-butanoate