CAS 110545-69-2
:3-Bromo-4-methoxythiophene
Description:
3-Bromo-4-methoxythiophene is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of a bromine atom at the 3-position and a methoxy group at the 4-position contributes to its unique chemical properties. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. It is known for its potential applications in organic electronics, particularly in the development of conductive polymers and materials for organic light-emitting diodes (OLEDs). The bromine substituent can enhance reactivity, making it suitable for further chemical modifications, while the methoxy group can influence the electronic properties of the molecule. Additionally, 3-Bromo-4-methoxythiophene may exhibit interesting photophysical properties, making it a subject of interest in materials science and organic synthesis. As with many organobromine compounds, it is important to handle it with care due to potential toxicity and environmental concerns.
Formula:C5H5BrOS
InChI:InChI=1S/C5H5BrOS/c1-7-5-3-8-2-4(5)6/h2-3H,1H3
InChI key:InChIKey=QEZGHSDUCNIDFZ-UHFFFAOYSA-N
SMILES:O(C)C=1C(Br)=CSC1
Synonyms:- Thiophene, 3-bromo-4-methoxy-
- 3-Methoxy-4-bromothiophene
- 3-Bromo-4-methoxythiophene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.