CAS 11055-06-4: Funiculosine

Description:Funiculosine, with the CAS number 11055-06-4, is a naturally occurring alkaloid primarily derived from certain fungal species, particularly those in the genus Penicillium. This compound is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. Funiculosine exhibits a range of pharmacological properties, including antimicrobial and antifungal activities, making it of interest in medicinal chemistry and pharmaceutical research. Its mechanism of action often involves interference with cellular processes in target organisms, which can lead to cell death or inhibition of growth. Additionally, funiculosine's solubility and stability can vary depending on environmental conditions, influencing its efficacy and application in various formulations. Research into funiculosine continues to explore its potential therapeutic uses, as well as its role in natural product chemistry and the development of new antimicrobial agents. As with many natural compounds, further studies are necessary to fully elucidate its properties and potential applications in medicine and industry.

Formula:C₂₇H₄₁NO₇

InChI:InChI=1S/C27H41NO7/c1-7-13(2)10-14(3)11-16(5)26-15(4)8-9-18(35-26)20-21(29)17(12-28(6)27(20)34)19-22(30)24(32)25(33)23(19)31/h8,11-14,18-19,22-26,29-33H,7,9-10H2,1-6H3/b16-11+/t13-,14+,18-,19-,22+,23-,24+,25-,26+/m1/s1

InChI key:InChIKey=UTZTYDYZCJIRLN-GKDKEGFTSA-N

SMILES:O=C1C(=C(O)C(=CN1C)C2C(O)C(O)C(O)C2O)C3OC(C(=CC3)C)C(=CC(C)CC(C)CC)C

Synonyms:
2(1H)-Pyridinone, 3-[3,6-dihydro-5-methyl-6-(1,3,5-trimethyl-1-heptenyl)-2H-pyran-2-yl]-4-hydroxy-1-methyl-5-(2,3,4,5-tetrahydroxycyclopentyl)-, stereoisomer
3-[(2R,6S)-3,6-Dihydro-5-methyl-6-[(1E,3S,5R)-1,3,5-trimethyl-1-hepten-1-yl]-2H-pyran-2-yl]-4-hydroxy-1-methyl-5-[(1α,2α,3α,4α,5α)-2,3,4,5-tetrahydroxycyclopentyl]-2(1H)-pyridinone
Funiculosine
2(1H)-Pyridinone, 3-[(2R,6S)-3,6-dihydro-5-methyl-6-[(1E,3S,5R)-1,3,5-trimethyl-1-hepten-1-yl]-2H-pyran-2-yl]-4-hydroxy-1-methyl-5-[(1α,2α,3α,4α,5α)-2,3,4,5-tetrahydroxycyclopentyl]-
2(1H)-Pyridinone, 3-[(2R,6S)-3,6-dihydro-5-methyl-6-[(1E,3S,5R)-1,3,5-trimethyl-1-heptenyl]-2H-pyran-2-yl]-4-hydroxy-1-methyl-5-[(1α,2α,3α,4α,5α)-2,3,4,5-tetrahydroxycyclopentyl]-