CAS 110556-33-7

(+)-methyl (R)-3-bromo-2-methyl propionate

Description:

(+)-Methyl (R)-3-bromo-2-methyl propionate, with the CAS number 110556-33-7, is an organic compound characterized by its chiral nature, which is indicated by the (R) configuration at the stereocenter. This compound features a bromine atom attached to the third carbon of a propionate chain, contributing to its reactivity and potential applications in organic synthesis. The presence of the methyl group at the second carbon enhances its steric properties, influencing its interactions in chemical reactions. As an ester, it exhibits typical ester characteristics, such as volatility and solubility in organic solvents. The compound's chirality may lead to different biological activities compared to its enantiomers, making it of interest in pharmaceutical applications. Additionally, the bromine substituent can facilitate nucleophilic substitution reactions, making it a valuable intermediate in the synthesis of more complex molecules. Overall, (+)-methyl (R)-3-bromo-2-methyl propionate is a versatile compound with significant implications in synthetic organic chemistry.

Formula: C₅H₉BrO₂

InChI: InChI=1/C5H9BrO2/c1-4(3-6)5(7)8-2/h4H,3H2,1-2H3/t4-/m0/s1

SMILES: C[C@@H](CBr)C(=O)OC

Synonyms:

• Methyl (R)-(+)-3-bromo-2-methylpropionate
• (R)-(+)-3-Bromoisobutyric acid methyl ester
• methyl (2R)-3-bromo-2-methylpropanoate

METHYL (R)-(+)-3-BROMO-2-METHYLPROPIONATE

CAS: 110556-33-7

Formula: C₅H₉BrO₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 181.0278

Ref: IN-DA003RIY

(R)-(+)-3-Bromoisobutyric acid methyl ester

CAS: 110556-33-7

(R)-(+)-3-Bromoisobutyric acid methyl ester

Purity: 95%

Molecular weight: 181.03g/mol

Ref: 54-OR938686

(R)-Methyl 3-bromo-2-methylpropanoate

CAS: 110556-33-7

Formula: C₅H₉BrO₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 181.029

Ref: 10-F053967