CAS 1105663-98-6

1-(1,1-Dimethylethyl) 3-methyl 3-(aminomethyl)-1,3-azetidinedicarboxylate

Description:

1-(1,1-Dimethylethyl) 3-methyl 3-(aminomethyl)-1,3-azetidinedicarboxylate, with the CAS number 1105663-98-6, is a chemical compound characterized by its azetidine ring structure, which is a four-membered cyclic amine. This compound features two carboxylate functional groups, contributing to its potential as a versatile building block in organic synthesis. The presence of the tert-butyl group (1,1-dimethylethyl) and the methyl group enhances its steric properties, which can influence its reactivity and interaction with biological systems. The aminomethyl substituent suggests potential for further functionalization, making it of interest in medicinal chemistry and drug development. Additionally, the compound's structural features may impart specific solubility and stability characteristics, which are crucial for its application in various chemical processes. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly those with potential pharmaceutical applications.

Formula: C₁₁H₂₀N₂O₄

InChI: InChI=1S/C11H20N2O4/c1-10(2,3)17-9(15)13-6-11(5-12,7-13)8(14)16-4/h5-7,12H2,1-4H3

InChI key: InChIKey=HNFOHFRPRUJBQA-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1(CN)CN(C(OC(C)(C)C)=O)C1

Synonyms:

• 1,3-Azetidinedicarboxylic acid, 3-(aminomethyl)-, 1-(1,1-dimethylethyl) 3-methyl ester
• 1-tert-Butyl 3-methyl 3-(aminomethyl)azetidine-1,3-dicarboxylate
• 1-(1,1-Dimethylethyl) 3-methyl 3-(aminomethyl)-1,3-azetidinedicarboxylate