CAS 1105675-62-4
:5-Methoxy-N-phenyl-4-(trimethylsilyl)-3-pyridinecarboxamide
Description:
5-Methoxy-N-phenyl-4-(trimethylsilyl)-3-pyridinecarboxamide is a chemical compound characterized by its complex structure, which includes a pyridine ring, a methoxy group, and a trimethylsilyl substituent. This compound typically exhibits properties associated with amides, such as moderate polarity and potential for hydrogen bonding due to the presence of the amide functional group. The trimethylsilyl group enhances its lipophilicity and may influence its solubility in organic solvents. The methoxy group can also affect the electronic properties of the molecule, potentially impacting its reactivity and interaction with biological targets. This compound may be of interest in medicinal chemistry and material science due to its unique structural features, which could confer specific biological activities or facilitate interactions in various chemical environments. Its synthesis and applications would likely be explored in the context of drug development or as a reagent in organic synthesis. As with any chemical, safety data and handling precautions should be reviewed before use.
Formula:C16H20N2O2Si
InChI:InChI=1S/C16H20N2O2Si/c1-20-14-11-17-10-13(15(14)21(2,3)4)16(19)18-12-8-6-5-7-9-12/h5-11H,1-4H3,(H,18,19)
InChI key:InChIKey=DANYRTOROYBZFN-UHFFFAOYSA-N
SMILES:C(NC1=CC=CC=C1)(=O)C=2C([Si](C)(C)C)=C(OC)C=NC2
Synonyms:- 3-Pyridinecarboxamide, 5-methoxy-N-phenyl-4-(trimethylsilyl)-
- 5-Methoxy-N-phenyl-4-(trimethylsilyl)-3-pyridinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.