CymitQuimica logo

CAS 1105675-63-5

:

2,6-Dibromo-5-iodo-3-pyridinol

Description:
2,6-Dibromo-5-iodo-3-pyridinol is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 2 and 6 positions with bromine atoms and at the 5 position with an iodine atom. This compound features a hydroxyl group (-OH) at the 3 position, contributing to its classification as a pyridinol. The presence of multiple halogen substituents enhances its reactivity and potential applications in various chemical reactions, including nucleophilic substitutions and coupling reactions. The compound is likely to exhibit moderate to high polarity due to the electronegative halogens and the hydroxyl group, influencing its solubility in polar solvents. Additionally, the presence of halogens may impart biological activity, making it of interest in medicinal chemistry and agrochemical research. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed. Overall, 2,6-Dibromo-5-iodo-3-pyridinol is a versatile compound with potential applications in synthetic chemistry and pharmaceuticals.
Formula:C5H2Br2INO
InChI:InChI=1S/C5H2Br2INO/c6-4-2(8)1-3(10)5(7)9-4/h1,10H
InChI key:InChIKey=ROFLBQPJOBJFTH-UHFFFAOYSA-N
SMILES:IC1=C(Br)N=C(Br)C(O)=C1
Synonyms:
  • 2,6-Dibromo-5-iodo-3-pyridinol
  • 3-Pyridinol, 2,6-dibromo-5-iodo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.