CAS 1105679-26-2

α-Amino-3-bromobenzeneacetamide

Description:

α-Amino-3-bromobenzeneacetamide is an organic compound characterized by the presence of an amino group, a bromobenzene moiety, and an acetamide functional group. This compound features a bromine atom substituted at the meta position of the benzene ring relative to the acetamide group, which influences its reactivity and physical properties. The amino group contributes to its basicity and potential for forming hydrogen bonds, while the acetamide group enhances its solubility in polar solvents. The presence of the bromine atom can also impart unique electronic properties, making it a useful intermediate in various synthetic applications, including pharmaceuticals and agrochemicals. The compound's structure allows for potential interactions with biological targets, which may be explored in medicinal chemistry. Additionally, its molecular characteristics may influence its stability, melting point, and solubility, making it relevant in both research and industrial contexts. As with many brominated compounds, considerations regarding environmental impact and safety are essential during handling and application.

Formula: C₈H₉BrN₂O

InChI: InChI=1S/C8H9BrN2O/c9-6-3-1-2-5(4-6)7(10)8(11)12/h1-4,7H,10H2,(H2,11,12)

InChI key: InChIKey=KNVHYQXHBGNHLQ-UHFFFAOYSA-N

SMILES: C(C(N)=O)(N)C1=CC(Br)=CC=C1

Synonyms:

• α-Amino-3-bromobenzeneacetamide
• Benzeneacetamide, α-amino-3-bromo-
• 2-Amino-2-(3-bromophenyl)acetamide

2-Amino-2-(3-bromophenyl)acetamide

CAS: 1105679-26-2

Versatile small molecule scaffold

Formula: C₈H₉BrN₂O

Purity: Min. 95%

Molecular weight: 229.07 g/mol

Ref: 3D-FUB67926