CAS 110570-93-9
:MYOMODULIN
Description:
Myomodulin, with the CAS number 110570-93-9, is a neuropeptide that plays a significant role in the modulation of muscle activity and has been studied for its effects on neuromuscular functions. It is primarily found in certain invertebrates, particularly in the nervous systems of mollusks, where it is involved in the regulation of muscle contraction and relaxation. Myomodulin is characterized by its structure, which includes a specific sequence of amino acids that contribute to its biological activity. This peptide is known to interact with various receptors, influencing neurotransmission and muscle physiology. Research has indicated that myomodulin may have potential applications in understanding muscle disorders and developing therapeutic strategies. Its unique properties make it a subject of interest in neurobiology and pharmacology, particularly in the context of muscle control and neuromuscular diseases. Overall, myomodulin exemplifies the intricate relationship between neuropeptides and muscle function in biological systems.
Formula:C36H67N11O8S2
InChI:InChI=1/C36H67N11O8S2/c1-20(2)17-26(29(37)49)45-31(51)23(10-8-14-41-36(38)39)42-34(54)27(18-21(3)4)46-32(52)24(11-15-56-5)44-35(55)28(19-48)47-33(53)25(12-16-57-6)43-30(50)22-9-7-13-40-22/h20-28,40,48H,7-19H2,1-6H3,(H2,37,49)(H,42,54)(H,43,50)(H,44,55)(H,45,51)(H,46,52)(H,47,53)(H4,38,39,41)/t22-,23-,24-,25-,26-,27-,28-/m0/s1
SMILES:CC(C)C[C@@H](C(=N)O)N=C([C@H](CCCNC(=N)N)N=C([C@H](CC(C)C)N=C([C@H](CCSC)N=C([C@H](CO)N=C([C@H](CCSC)N=C([C@@H]1CCCN1)O)O)O)O)O)O
Synonyms:- Myomoduline A (Aplysia californica)
- L-prolyl-L-methionyl-L-seryl-L-methionyl-L-leucyl-N~5~-(diaminomethylidene)-L-ornithyl-L-leucinamide
- Myomodulin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Myomodulin
CAS:Myomodulin is a neuropeptide present in molluscs, insects, and gastropods.Myomodulin is present in two identified aplysia neurons that contain myomodulin A theFormula:C36H67N11O8S2Purity:98%Color and Shape:SolidMolecular weight:846.12Myomodulin
CAS:Myomodulin is a protein that is found in the carboxy terminal end of a fatty acid, which has been shown to be effective at treating infectious diseases such as Stenotrophomonas maltophilia. Myomodulin has also been shown to have ganglia protective effects and can increase levels of cAMP in cells. It is also used as a pharmaceutical drug for inflammatory diseases. Myomodulin is also used in diagnostic agents for inflammatory diseases. Myomodulin is an amino acid that regulates the body's immune system by inhibiting inflammation. It works by blocking the production of prostaglandin E2 (PGE2) in macrophages, which are cells that produce pro-inflammatory cytokines and histamine. This prevents the production of PGE2 from arachidonic acid, which causes inflammation and pain.Formula:C38H68F3N11O10S2Purity:Min. 95%Molecular weight:960.1 g/mol

