
CAS 110578-28-4
:Ethyl 5-(2-methoxyphenyl)-3-isoxazolecarboxylate
Description:
Ethyl 5-(2-methoxyphenyl)-3-isoxazolecarboxylate, with the CAS number 110578-28-4, is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This substance features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of the 2-methoxyphenyl group enhances its aromatic characteristics, potentially influencing its biological activity and interactions. Typically, compounds of this nature may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The isoxazole moiety is known for its role in various biological activities, including anti-inflammatory and analgesic effects. Additionally, the compound's stability, melting point, and solubility in organic solvents can vary based on its molecular interactions. Overall, Ethyl 5-(2-methoxyphenyl)-3-isoxazolecarboxylate represents a class of compounds that may be explored for their potential applications in drug development and other chemical syntheses.
Formula:C13H13NO4
InChI:InChI=1S/C13H13NO4/c1-3-17-13(15)10-8-12(18-14-10)9-6-4-5-7-11(9)16-2/h4-8H,3H2,1-2H3
InChI key:InChIKey=RPROQDMCKZZOBB-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC=C1)C2=CC(C(OCC)=O)=NO2
Synonyms:- Ethyl 5-(2-methoxyphenyl)-3-isoxazolecarboxylate
- 3-Isoxazolecarboxylic acid, 5-(2-methoxyphenyl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.