CAS 110578-98-8

2-[(2-methyl-5-nitro-1H-imidazol-4-yl)sulfanyl]acetamide

Description:

2-[(2-methyl-5-nitro-1H-imidazol-4-yl)sulfanyl]acetamide, with the CAS number 110578-98-8, is a chemical compound characterized by its imidazole ring structure, which contributes to its biological activity. This compound features a sulfanyl (thioether) group attached to an acetamide moiety, indicating potential reactivity and interaction with biological systems. The presence of a nitro group on the imidazole ring enhances its electron-withdrawing properties, which can influence its pharmacological profile. Typically, compounds with such structures may exhibit antimicrobial or antiparasitic properties, making them of interest in medicinal chemistry. The molecular structure suggests that it may engage in hydrogen bonding due to the amide functional group, which can affect solubility and interaction with biological targets. Additionally, the methyl and nitro substituents can impact the compound's lipophilicity and overall stability. Overall, this compound's unique structural features position it as a candidate for further research in drug development and therapeutic applications.

Formula: C₆H₈N₄O₃S

InChI: InChI=1/C6H8N4O3S/c1-3-8-5(10(12)13)6(9-3)14-2-4(7)11/h2H2,1H3,(H2,7,11)(H,8,9)

Synonyms:

• 2-[(2-Methyl-4-nitro-1H-imidazol-5-yl)sulfanyl]acetamide
• Acetamide, 2-[(2-methyl-4-nitro-1H-imidazol-5-yl)thio]-