CAS 110590-63-1
:glycyl-tyrosyl-isoleucyl-glycyl-seryl-arginine
Description:
Glycyl-tyrosyl-isoleucyl-glycyl-seryl-arginine, identified by its CAS number 110590-63-1, is a synthetic peptide composed of five amino acids: glycine, tyrosine, isoleucine, serine, and arginine. This peptide exhibits characteristics typical of peptides, including solubility in water and potential bioactivity, depending on its sequence and structure. The presence of arginine, a positively charged amino acid, may contribute to its interaction with negatively charged biomolecules, enhancing its biological activity. The aromatic side chain of tyrosine can participate in π-π stacking interactions, which may influence its stability and interactions in biological systems. Additionally, the peptide's structure may allow for specific conformations that are crucial for its function, such as enzyme activity or receptor binding. Overall, the properties of this peptide can be influenced by factors such as pH, temperature, and the presence of other ions or molecules, making it a subject of interest in biochemical and pharmaceutical research.
Formula:C28H45N9O9
InChI:InChI=1/C28H45N9O9/c1-3-15(2)23(37-24(42)19(34-21(40)12-29)11-16-6-8-17(39)9-7-16)26(44)33-13-22(41)35-20(14-38)25(43)36-18(27(45)46)5-4-10-32-28(30)31/h6-9,15,18-20,23,38-39H,3-5,10-14,29H2,1-2H3,(H,33,44)(H,34,40)(H,35,41)(H,36,43)(H,37,42)(H,45,46)(H4,30,31,32)/t15-,18-,19-,20-,23-/m0/s1
SMILES:CC[C@H](C)[C@@H](C(=NCC(=N[C@@H](CO)C(=N[C@@H](CCCNC(=N)N)C(=O)O)O)O)O)N=C([C@H](Cc1ccc(cc1)O)N=C(CN)O)O
Synonyms:- Gly-tyr-ile-gly-ser-arg
- Gyigsr
- L-Arginine, N2-(N-(N-(N-(N-glycyl-L-tyrosyl)-L-isoleucyl)glycyl)-L-seryl)-
- glycyl-L-tyrosyl-L-isoleucylglycyl-L-seryl-N~5~-(diaminomethylidene)-L-ornithine
- Glycyl-tyrosyl-isoleucyl-glycyl-seryl-arginine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.