CAS 110590-64-2
:tyr-ile-gly-ser-arg
Description:
The chemical substance referred to as "tyr-ile-gly-ser-arg" corresponds to a peptide sequence composed of the amino acids tyrosine (Tyr), isoleucine (Ile), glycine (Gly), serine (Ser), and arginine (Arg). This peptide is characterized by its specific arrangement of these amino acids, which influences its biological activity and properties. Peptides like this one can exhibit various functions, including roles in signaling, enzyme activity, and cellular communication. The presence of aromatic (tyrosine), branched-chain (isoleucine), and polar (serine) amino acids contributes to the peptide's hydrophobic and hydrophilic characteristics, affecting its solubility and interaction with biological membranes. Additionally, the basic nature of arginine can play a crucial role in binding to negatively charged molecules, such as nucleic acids. The CAS number 110590-64-2 uniquely identifies this specific peptide, facilitating its recognition in scientific literature and databases. Overall, the characteristics of this peptide make it a subject of interest in biochemistry and pharmacology for potential therapeutic applications.
Formula:C26H42N8O8
InChI:InChI=1/C26H42N8O8/c1-3-14(2)21(34-22(38)17(27)11-15-6-8-16(36)9-7-15)24(40)31-12-20(37)32-19(13-35)23(39)33-18(25(41)42)5-4-10-30-26(28)29/h6-9,14,17-19,21,35-36H,3-5,10-13,27H2,1-2H3,(H,31,40)(H,32,37)(H,33,39)(H,34,38)(H,41,42)(H4,28,29,30)
SMILES:CCC(C)C(C(=NCC(=NC(CO)C(=NC(CCCNC(=N)N)C(=O)O)O)O)O)N=C(C(Cc1ccc(cc1)O)N)O
Synonyms:- H-Tyr-Ile-Gly-Ser-Arg-OH
- Laminin Pentapeptide
- L-tyrosyl-L-isoleucylglycyl-L-seryl-N~5~-(diaminomethylidene)-L-ornithine
- tyrosylisoleucylglycylseryl-N~5~-(diaminomethylidene)ornithine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Laminin (929-933)
CAS:For cellular and molecular biology applications
Color and Shape:White, Lyophilized powderH-Tyr-Ile-Gly-Ser-Arg-OH
CAS:YIGSRFormula:C26H42N8O8Purity:98.6%Color and Shape:White LyophilisateMolecular weight:594.67H-Tyr-Ile-Gly-Ser-Arg-OH trifluoroacetate salt
CAS:The H-Tyr-Ile-Gly-Ser-Arg-OH trifluoroacetate salt is a synthetic peptide that has been shown to promote neuronal growth and axonal regeneration. This compound has been synthesized using a biocompatible polymer, collagen gel, and neurotrophic factors. The peptide is also able to stimulate the synthesis of collagen in mesenchymal cells cultured in tissue culture. The peptide can be used for treatment of subcutaneous tumors and neural injury.
Formula:C26H42N8O8Purity:Min. 95%Molecular weight:594.66 g/mol
