
CAS 1105933-56-9
:6-Amino-5-methoxy-3-pyridinol
Description:
6-Amino-5-methoxy-3-pyridinol is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features an amino group (-NH2) and a methoxy group (-OCH3) attached to the pyridine ring, specifically at the 6 and 5 positions, respectively. The presence of these functional groups contributes to its potential reactivity and solubility in various solvents. It is typically a solid at room temperature and may exhibit properties such as moderate polarity due to the amino and methoxy substituents. The compound may be of interest in medicinal chemistry and research due to its structural features, which could influence biological activity. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including purification methods like crystallization or chromatography. As with many pyridine derivatives, it may also participate in hydrogen bonding, affecting its interactions in biological systems or chemical reactions.
Formula:C6H8N2O2
InChI:InChI=1S/C6H8N2O2/c1-10-5-2-4(9)3-8-6(5)7/h2-3,9H,1H3,(H2,7,8)
InChI key:InChIKey=ZKTGLHZVXZHNOY-UHFFFAOYSA-N
SMILES:O(C)C1=C(N)N=CC(O)=C1
Synonyms:- 3-Pyridinol, 6-amino-5-methoxy-
- 6-Amino-5-methoxy-3-pyridinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.