CAS 1105988-65-5

4-Methoxy-6-(trifluoromethyl)-3-pyridinecarboxylic acid

Description:

4-Methoxy-6-(trifluoromethyl)-3-pyridinecarboxylic acid is an organic compound characterized by its pyridine ring, which is substituted at the 4-position with a methoxy group and at the 6-position with a trifluoromethyl group. This compound features a carboxylic acid functional group at the 3-position of the pyridine ring, contributing to its acidic properties. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in pharmaceutical research. The methoxy group can also affect the compound's solubility and reactivity. Overall, this compound is likely to exhibit unique chemical behavior due to the combination of electron-withdrawing and electron-donating substituents, which can impact its interactions in various chemical environments. Its specific applications may include use in agrochemicals or as an intermediate in the synthesis of more complex molecules. As with many pyridine derivatives, it may also exhibit interesting pharmacological properties, warranting further investigation.

Formula: C₈H₆F₃NO₃

InChI: InChI=1S/C8H6F3NO3/c1-15-5-2-6(8(9,10)11)12-3-4(5)7(13)14/h2-3H,1H3,(H,13,14)

InChI key: InChIKey=XCWKLVBHARRUAL-UHFFFAOYSA-N

SMILES: O(C)C=1C(C(O)=O)=CN=C(C(F)(F)F)C1

Synonyms:

• 4-Methoxy-6-(trifluoromethyl)-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 4-methoxy-6-(trifluoromethyl)-