CAS 110605-64-6
:Isaglidole
Description:
Isaglidole, identified by its CAS number 110605-64-6, is a chemical compound that belongs to the class of organic molecules known as cyclic amines. It is characterized by its unique molecular structure, which includes a nitrogen atom incorporated into a cyclic framework. This compound exhibits properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity in various chemical environments. Isaglidole is often studied for its potential applications in pharmaceuticals and agrochemicals, where its structural features may contribute to biological activity. Additionally, its stability and reactivity can be affected by factors such as pH and temperature, making it an interesting subject for further research in synthetic chemistry and medicinal applications. As with many chemical substances, safety and handling precautions are essential when working with Isaglidole, given the potential for toxicity or reactivity under certain conditions.
Formula:C11H13FN4
InChI:InChI=1/C11H13FN4/c12-10-3-1-2-8-6-16(7-9(8)10)15-11-13-4-5-14-11/h1-3H,4-7H2,(H2,13,14,15)
SMILES:c1cc2CN(Cc2c(c1)F)NC1=NCCN1
Synonyms:- Isaglidole [INN]
- 4-Fluoro-2-(2-imidazolin-2-ylamino)isoindoline
- Unii-B51Uc955Kq
- N-(4,5-dihydro-1H-imidazol-2-yl)-4-fluoro-1,3-dihydro-2H-isoindol-2-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.