CAS 110622-75-8
:N-desmethyltimelotem
Description:
N-desmethyltimelotem, identified by its CAS number 110622-75-8, is a chemical compound that serves as a metabolite of timelotem, a drug primarily used in the treatment of certain medical conditions. This substance is characterized by its structural modifications, specifically the absence of a methyl group on the nitrogen atom of the timelotem molecule. As a result, N-desmethyltimelotem may exhibit different pharmacological properties compared to its parent compound, including variations in potency, efficacy, and side effects. The compound is typically studied in the context of drug metabolism and pharmacokinetics, as understanding its behavior in biological systems can provide insights into the overall therapeutic profile of timelotem. Additionally, N-desmethyltimelotem may be relevant in toxicological assessments and drug interaction studies. Its solubility, stability, and reactivity are influenced by its chemical structure, which can affect its behavior in various environments, including biological systems.
Formula:C16H16FN3S
InChI:InChI=1/C16H16FN3S/c17-11-3-4-13-14(8-11)20-6-5-18-9-12(20)10-19-16(13)15-2-1-7-21-15/h1-4,7-8,12,18H,5-6,9-10H2
SMILES:c1cc(C2=NCC3CNCCN3c3cc(ccc23)F)sc1
Synonyms:- 10-Fluoro-1,2,3,4,4a,5-hexahydro-7-(2-thienyl)pyrazino(1,2-a)(1,4)benzodiazepine
- Kc 8122
- N-Demethyltimelotem
- Pyrazino(1,2-a)(1,4)benzodiazepine, 10-fluoro-1,2,3,4,4a,5-hexahydro-7-(2-thienyl)-
- 10-Fluoro-7-(Thiophen-2-Yl)-1,2,3,4,4A,5-Hexahydropyrazino[1,2-A][1,4]Benzodiazepine
- N-Desmethyltimelotem
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.