CAS 1106304-74-8
:Ethyl 3-bromo-2-methoxybenzoate
Description:
Ethyl 3-bromo-2-methoxybenzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid. It features a bromine atom at the 3-position and a methoxy group (-OCH3) at the 2-position of the aromatic ring, contributing to its unique reactivity and properties. The presence of the ethyl ester group enhances its solubility in organic solvents, making it useful in various chemical reactions and applications. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its molecular structure allows for potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the bromine substituent can serve as a site for further chemical modifications, making it a valuable intermediate in synthetic chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, Ethyl 3-bromo-2-methoxybenzoate is a versatile compound with significant utility in chemical research and industry.
Formula:C10H11BrO3
InChI:InChI=1S/C10H11BrO3/c1-3-14-10(12)7-5-4-6-8(11)9(7)13-2/h4-6H,3H2,1-2H3
InChI key:InChIKey=PHJKWQJEAOPVDK-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(OC)C(Br)=CC=C1
Synonyms:- 2-Methoxy-3-bromobenzoic acid ethyl ester
- Ethyl 3-bromo-2-methoxybenzoate
- Benzoic acid, 3-bromo-2-methoxy-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
