CymitQuimica logo

CAS 110632-59-2

:

3-Isothiazolecarboxylic acid, 5-methyl-

Description:
3-Isothiazolecarboxylic acid, 5-methyl- is a heterocyclic organic compound characterized by the presence of an isothiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidic properties. The methyl group at the 5-position of the isothiazole ring influences its reactivity and solubility. Typically, compounds of this nature exhibit biological activity, making them of interest in pharmaceuticals and agrochemicals. The presence of the isothiazole moiety often imparts unique chemical properties, such as the ability to participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Additionally, the compound's structure may allow for interactions with biological targets, which can be explored for potential therapeutic applications. Overall, 3-Isothiazolecarboxylic acid, 5-methyl- is a versatile compound with significant implications in chemical research and development.
Formula:C5H5NO2S
InChI:InChI=1S/C5H5NO2S/c1-3-2-4(5(7)8)6-9-3/h2H,1H3,(H,7,8)
InChI key:QRHWGPSYZLZEMB-UHFFFAOYSA-N
SMILES:CC1=CC(=NS1)C(=O)O
Found 4 products.