CAS 110637-45-1

1,2-Pyrrolidinedicarboxylic acid, 1-(2-propen-1-yl) ester, compd. with N-cyclohexylcyclohexanamine (1:1), (2S)-

Description:

1,2-Pyrrolidinedicarboxylic acid, 1-(2-propen-1-yl) ester, compd. with N-cyclohexylcyclohexanamine (1:1), (2S)-, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and multiple functional groups. This compound features a dicarboxylic acid moiety, indicating the presence of two carboxylic acid groups, and an ester linkage derived from the propenyl group. The presence of N-cyclohexylcyclohexanamine suggests that it forms a salt or complex with this amine, which may influence its solubility and reactivity. The (2S)- designation indicates that the compound has a specific stereochemistry, which can affect its biological activity and interaction with other molecules. Generally, compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the presence of both hydrophilic (carboxylic acid) and hydrophobic (cyclohexyl) components can lead to unique solubility characteristics, potentially impacting its application in various chemical and pharmaceutical contexts.

Formula: C₁₂H₂₃N·C₉H₁₃NO₄

InChI: InChI=1S/C12H23N.C9H13NO4/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-6-14-9(13)10-5-3-4-7(10)8(11)12/h11-13H,1-10H2;2,7H,1,3-6H2,(H,11,12)/t;7-/m.0/s1

InChI key: InChIKey=HOGYDVYIVOFJTQ-ZLTKDMPESA-N

SMILES: C(OCC=C)(=O)N1[C@H](C(O)=O)CCC1.N(C1CCCCC1)C2CCCCC2

Synonyms:

• 1,2-Pyrrolidinedicarboxylic acid, 1-(2-propen-1-yl) ester, compd. with N-cyclohexylcyclohexanamine (1:1), (2S)-
• 1,2-Pyrrolidinedicarboxylic acid, 1-(2-propenyl) ester, (S)-, compd. with N-cyclohexylcyclohexanamine (1:1)