CymitQuimica logo

CAS 110638-01-2

:

4-MORPHOLIN-4-YL-1,2,5-THIADIAZOL-3-YL CHLOROACETATE

Description:
4-Morpholin-4-yl-1,2,5-thiadiazol-3-yl chloroacetate is a chemical compound characterized by its unique structure, which includes a morpholine ring and a thiadiazole moiety. This compound typically exhibits properties associated with both heterocyclic and halogenated organic compounds. It is likely to be a white to off-white solid, soluble in polar organic solvents, and may have moderate stability under standard conditions. The presence of the chloroacetate group suggests potential reactivity, particularly in nucleophilic substitution reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of agrochemicals or medicinal agents. Its molecular structure allows for interactions with biological targets, which could lead to various pharmacological effects. Safety data should be consulted for handling and exposure guidelines, as halogenated compounds can pose health risks. Overall, 4-Morpholin-4-yl-1,2,5-thiadiazol-3-yl chloroacetate represents a class of compounds with diverse applications in chemistry and biology.
Formula:C8H10ClN3O3S
InChI:InChI=1/C8H10ClN3O3S/c9-5-6(13)15-8-7(10-16-11-8)12-1-3-14-4-2-12/h1-5H2
SMILES:C1COCCN1c1c(nsn1)OC(=O)CCl
Synonyms:
  • 4-Morpholin-4-yl-1,2,5-thiadiazol-3-yl chloroacetate 97%
  • (4-Morpholino-1,2,5-Thiadiazol-3-Yl) 2-Chloroacetate
Found 1 products.