CAS 110642-44-9: Epmedin C
Description:Epimedin C is a flavonoid compound primarily derived from the traditional Chinese medicinal herb Epimedium, commonly known as Horny Goat Weed. It is recognized for its potential pharmacological properties, including antioxidant, anti-inflammatory, and neuroprotective effects. Structurally, Epimedin C features a flavonol backbone, which contributes to its biological activity. This compound has garnered interest in research for its possible role in enhancing sexual function and improving bone health, particularly in the context of osteoporosis. Additionally, studies suggest that Epimedin C may influence various signaling pathways, including those related to nitric oxide production, which is crucial for vascular health. Its solubility and stability in different solvents can vary, impacting its bioavailability and efficacy. As with many natural compounds, further research is necessary to fully elucidate its mechanisms of action and therapeutic potential, as well as to assess any possible side effects or interactions with other medications.
Formula:C39H50O19
InChI:InChI=1/C39H50O19/c1-14(2)6-11-19-21(54-38-32(50)29(47)26(44)22(13-40)55-38)12-20(41)23-27(45)35(33(56-34(19)23)17-7-9-18(51-5)10-8-17)57-39-36(30(48)25(43)16(4)53-39)58-37-31(49)28(46)24(42)15(3)52-37/h6-10,12,15-16,22,24-26,28-32,36-44,46-50H,11,13H2,1-5H3/t15-,16-,22+,24-,25-,26+,28+,29-,30+,31+,32+,36+,37-,38+,39-/m0/s1
- Synonyms:
- Epimedin C
- Epimedin C(Primary Standard)
- 3-((6-Deoxy-2-O-(6-deoxy-alpha-L-mannopyranosyl)-alpha-L-mannopyranosyl)oxy)-7-(beta-D-glucopyranosyloxy)-5-hydroxy-2-(4-methoxyphenyl)-8-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one
- (4-Methoxyphenyl)-8-(3-Methyl-2-Buten-1-Yl)-
- 4H-1-Benzopyran-4-one,3-[[6-deoxy-2-O-(6-deoxy-α-L-mannopyranosyl)- α-L-mannopyranosyl]oxy]-
- 7-(β-D-glucopyranosyloxy)-5-hydroxy-2-
- 3-{[6-deoxy-2-O-(6-deoxy-alpha-L-mannopyranosyl)-alpha-L-mannopyranosyl]oxy}-5-hydroxy-2-(4-methoxyphenyl)-8-(3-methylbut-2-en-1-yl)-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside