CymitQuimica logo

CAS 110654-36-9

:

N-(Phenylmethyl)benzenemethanesulfonamide

Description:
N-(Phenylmethyl)benzenemethanesulfonamide, also known by its CAS number 110654-36-9, is an organic compound characterized by the presence of a sulfonamide functional group attached to a benzene ring. This compound features a phenylmethyl group, which contributes to its aromatic nature and potential hydrophobic interactions. The sulfonamide group imparts unique chemical properties, including the ability to form hydrogen bonds, which can influence its solubility and reactivity. Typically, compounds of this nature exhibit moderate to high stability under standard conditions, although they may be sensitive to strong acids or bases. The presence of multiple aromatic rings suggests potential applications in pharmaceuticals, particularly in drug design, due to their ability to interact with biological targets. Additionally, the compound may exhibit specific biological activities, making it of interest in medicinal chemistry. Overall, N-(Phenylmethyl)benzenemethanesulfonamide is a versatile compound with potential applications in various fields, including organic synthesis and drug development.
Formula:C14H15NO2S
InChI:InChI=1S/C14H15NO2S/c16-18(17,12-14-9-5-2-6-10-14)15-11-13-7-3-1-4-8-13/h1-10,15H,11-12H2
InChI key:InChIKey=FYRBPJQSGABSBF-UHFFFAOYSA-N
SMILES:C(S(NCC1=CC=CC=C1)(=O)=O)C2=CC=CC=C2
Synonyms:
  • Benzenemethanesulfonamide, N-(phenylmethyl)-
  • N-(Phenylmethyl)benzenemethanesulfonamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.