CAS 110654-37-0
:N-(4-Nitrophenyl)benzenemethanesulfonamide
Description:
N-(4-Nitrophenyl)benzenemethanesulfonamide, with the CAS number 110654-37-0, is a chemical compound characterized by its sulfonamide functional group, which is linked to a benzene ring substituted with a nitrophenyl group. This compound typically exhibits properties associated with sulfonamides, such as potential antibacterial activity, although its specific biological activity can vary. The presence of the nitro group suggests that it may have electron-withdrawing characteristics, influencing its reactivity and solubility in various solvents. The molecular structure indicates that it is likely to be a solid at room temperature, with potential applications in pharmaceuticals or as a chemical intermediate. Its stability, solubility, and reactivity can be influenced by the pH of the environment and the presence of other functional groups. Safety data should be consulted for handling and potential toxicity, as compounds with nitro and sulfonamide groups can pose health risks. Overall, this compound represents a specific class of organic molecules with diverse applications in medicinal chemistry and materials science.
Formula:C13H12N2O4S
InChI:InChI=1S/C13H12N2O4S/c16-15(17)13-8-6-12(7-9-13)14-20(18,19)10-11-4-2-1-3-5-11/h1-9,14H,10H2
InChI key:InChIKey=MKUUSIGEUBPQQH-UHFFFAOYSA-N
SMILES:N(S(CC1=CC=CC=C1)(=O)=O)C2=CC=C(N(=O)=O)C=C2
Synonyms:- Benzenemethanesulfonamide, N-(4-nitrophenyl)-
- N-(4-Nitrophenyl)benzenemethanesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.