CAS 110654-41-6

4-[(Aminosulfonyl)methyl]benzoic acid

Description:

4-[(Aminosulfonyl)methyl]benzoic acid, also known as a sulfonamide derivative, is characterized by its aminosulfonyl group attached to a benzoic acid structure. This compound typically exhibits properties such as solubility in polar solvents due to the presence of the sulfonamide functional group, which can engage in hydrogen bonding. The carboxylic acid moiety contributes to its acidic nature, allowing it to participate in various chemical reactions, including esterification and amidation. Its structure suggests potential applications in pharmaceuticals, particularly as an intermediate in the synthesis of biologically active compounds. The presence of the aminosulfonyl group may also impart antibacterial properties, similar to other sulfonamide drugs. Additionally, this compound may exhibit moderate stability under standard conditions, although it could be sensitive to extreme pH levels or reactive agents. Overall, 4-[(Aminosulfonyl)methyl]benzoic acid is a versatile compound with potential utility in medicinal chemistry and related fields.

Formula: C₈H₉NO₄S

InChI: InChI=1S/C8H9NO4S/c9-14(12,13)5-6-1-3-7(4-2-6)8(10)11/h1-4H,5H2,(H,10,11)(H2,9,12,13)

InChI key: InChIKey=RSQIWTKFJBNPJE-UHFFFAOYSA-N

SMILES: C(S(N)(=O)=O)C1=CC=C(C(O)=O)C=C1

Synonyms:

• 4-[(Aminosulfonyl)methyl]benzoic acid
• Benzoic acid, 4-[(aminosulfonyl)methyl]-

4-(Sulfamoylmethyl)benzoic acid

CAS: 110654-41-6

Versatile small molecule scaffold

Formula: C₈H₉NO₄S

Purity: Min. 95%

Molecular weight: 215.23 g/mol

Ref: 3D-KEA65441