CAS 110659-91-1
:psammaplin A
Description:
Psammaplin A is a naturally occurring compound classified as a brominated indole alkaloid, primarily isolated from marine sponges of the genus Psammaplysilla. It exhibits a complex molecular structure characterized by a bicyclic framework and multiple functional groups, including bromine atoms, which contribute to its unique chemical properties. Psammaplin A has garnered attention for its potential biological activities, including antimicrobial, antifungal, and anticancer properties, making it a subject of interest in pharmaceutical research. The compound's mechanism of action is believed to involve the inhibition of specific enzymes or pathways within target cells, although detailed studies are ongoing to elucidate these interactions. Additionally, its structural features may influence its solubility and reactivity, which are critical for its bioavailability and therapeutic efficacy. Overall, psammaplin A represents a fascinating example of marine-derived natural products with promising applications in drug discovery and development.
Formula:C22H24Br2N4O6S2
InChI:InChI=1/C22H24Br2N4O6S2/c23-15-9-13(1-3-19(15)29)11-17(27-33)21(31)25-5-7-35-36-8-6-26-22(32)18(28-34)12-14-2-4-20(30)16(24)10-14/h1-4,9-10,29-30,33-34H,5-8,11-12H2,(H,25,31)(H,26,32)/b27-17+,28-18+
Synonyms:- Benzenepropanamide, N,N'-(dithiodi-2,1-ethanediyl)bis(3-bromo-4-hydroxy-alpha-(hydroxyimino)-
- (2E,2'E)-N,N'-(disulfanediyldiethane-2,1-diyl)bis[3-(3-bromo-4-hydroxyphenyl)-2-(hydroxyimino)propanamide]
- Psammaplin A
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Psammaplin A
CAS:<p>Psammaplin A: marine-derived, inhibits HDAC/DNA methyltransferases, strong DAC1 blocker (IC50=0.9nM), antimicrobial against Gram-positive bacteria, anticancer.</p>Formula:C22H24Br2N4O6S2Color and Shape:SolidMolecular weight:664.38Psammaplin A
CAS:Controlled Product<p>Applications Psammaplin A is a DNA methyltransferase inhibitor.<br></p>Formula:C22H24Br2N4O6S2Color and Shape:Light Yellow To YellowMolecular weight:664.39

