
CAS 110661-60-4
:4-Methylbenzenemethanesulfonyl fluoride
Description:
4-Methylbenzenemethanesulfonyl fluoride, also known as methyl p-toluenesulfonyl fluoride (MTSF), is an organic compound characterized by its sulfonyl fluoride functional group attached to a methyl-substituted aromatic ring. It is typically a colorless to pale yellow liquid with a pungent odor. This compound is known for its reactivity, particularly as a sulfonylating agent in organic synthesis, where it can introduce sulfonyl groups into various substrates. MTSF is often utilized in the preparation of sulfonamides and other sulfonyl derivatives, making it valuable in medicinal chemistry and the development of pharmaceuticals. It is important to handle this substance with care, as it can be corrosive and may pose health risks upon exposure. Additionally, it is soluble in organic solvents, which facilitates its use in various chemical reactions. Proper storage and safety measures are essential due to its potential hazards, including irritation to the skin and respiratory system.
Formula:C8H9FO2S
InChI:InChI=1S/C8H9FO2S/c1-7-2-4-8(5-3-7)6-12(9,10)11/h2-5H,6H2,1H3
InChI key:InChIKey=HRBKXAXWOYMBCN-UHFFFAOYSA-N
SMILES:C(S(F)(=O)=O)C1=CC=C(C)C=C1
Synonyms:- Benzenemethanesulfonyl fluoride, 4-methyl-
- (p-Methylphenyl)methanesulfonyl fluoride
- 4-Methylbenzenemethanesulfonyl fluoride
- (4-Methylphenyl)methanesulfonyl fluoride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.