CAS 1106692-01-6

B-[2,3-Dihydro-1-(phenylmethyl)-1H-indol-5-yl]boronic acid

Description:

B-[2,3-Dihydro-1-(phenylmethyl)-1H-indol-5-yl]boronic acid is a boronic acid derivative characterized by its unique indole structure, which contributes to its potential applications in medicinal chemistry and organic synthesis. This compound features a boron atom bonded to a phenylmethyl-substituted indole, providing it with both electrophilic and nucleophilic properties. The presence of the boronic acid functional group allows for reversible covalent bonding with diols, making it useful in various chemical reactions, including Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds. Additionally, the indole moiety is known for its biological activity, often serving as a scaffold in drug development. The compound's solubility, stability, and reactivity can be influenced by the pH of the environment, as boronic acids can exist in different forms depending on the protonation state. Overall, B-[2,3-Dihydro-1-(phenylmethyl)-1H-indol-5-yl]boronic acid represents a versatile building block in organic synthesis and pharmaceutical research.

Formula: C₁₅H₁₆BNO₂

InChI: InChI=1S/C15H16BNO2/c18-16(19)14-6-7-15-13(10-14)8-9-17(15)11-12-4-2-1-3-5-12/h1-7,10,18-19H,8-9,11H2

InChI key: InChIKey=SMFVPKLSRGRXAW-UHFFFAOYSA-N

SMILES: C(N1C=2C(=CC(B(O)O)=CC2)CC1)C3=CC=CC=C3

Synonyms:

• B-[2,3-Dihydro-1-(phenylmethyl)-1H-indol-5-yl]boronic acid
• Boronic acid, B-[2,3-dihydro-1-(phenylmethyl)-1H-indol-5-yl]-