CAS 110683-10-8
:N-(p-Amylcinnamoyl)anthranilic acid
Description:
N-(p-Amylcinnamoyl)anthranilic acid is a chemical compound characterized by its unique structure, which includes an anthranilic acid moiety linked to a p-amylcinnamoyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. It is known for its role in various chemical reactions and may possess anti-inflammatory or analgesic properties, making it of interest in pharmaceutical research. The presence of the amyl group enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. Additionally, the compound may exhibit UV absorbance due to its conjugated double bonds, which can be relevant in photochemical applications. Its synthesis often involves coupling reactions, and it may be analyzed using techniques such as NMR and mass spectrometry to confirm its structure and purity. As with many organic compounds, safety and handling precautions should be observed, given its potential reactivity and biological effects.
Formula:C21H23NO3
InChI:InChI=1S/C21H23NO3/c1-2-3-4-7-16-10-12-17(13-11-16)14-15-20(23)22-19-9-6-5-8-18(19)21(24)25/h5-6,8-15H,2-4,7H2,1H3,(H,22,23)(H,24,25)
InChI key:InChIKey=GAMRBCZMOOMBSQ-UHFFFAOYSA-N
SMILES:N(C(C=CC1=CC=C(CCCCC)C=C1)=O)C2=C(C(O)=O)C=CC=C2
Synonyms:- 2-((1-Oxo-3-(4-pentylphenyl)-2-propenyl)amino)benzoic acid
- 2-[[1-Oxo-3-(4-pentylphenyl)-2-propen-1-yl]amino]benzoic acid
- 2-{[(2E)-3-(4-pentylphenyl)prop-2-enoyl]amino}benzoic acid
- 4-Acaa
- 4-Amylcinnamoylanthranilic acid
- Benzoic acid, 2-((1-oxo-3-(4-pentylphenyl)-2-propenyl)amino)-
- Benzoic acid, 2-[[1-oxo-3-(4-pentylphenyl)-2-propen-1-yl]amino]-
- N-(4-Pentylcinnamoyl)anthranilic acid
- N-(p-Amylcinnamoyl)anthranilic acid
- p-Amylcinnamoylanthranilic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
N-(4-Pentylcinnamoyl)anthranilic acid
CAS:Formula:C21H23NO3Purity:96%Color and Shape:SolidMolecular weight:337.4122N-(p-amylcinnamoyl) Anthranilic Acid
CAS:N-(p-amylcinnamoyl) Anthranilic AcidPurity:≥98%Molecular weight:337.41g/mol2-(3-(4-Pentylphenyl)Acrylamido)Benzoic Acid
CAS:2-(3-(4-Pentylphenyl)Acrylamido)Benzoic AcidPurity:98%Molecular weight:337.41g/molN-(p-amylcinnamoyl) Anthranilic Acid
CAS:<p>N-(p-amylcinnamoyl) Anthranilic Acid (ACA) is a broad spectrum Phospholipase A2 (PLA2) inhibitor and TRP channel blocker.</p>Formula:C21H23NO3Purity:99.35% - 99.67%Color and Shape:SolidMolecular weight:337.412-(3-(4-Pentylphenyl)acrylamido)benzoic acid
CAS:Formula:C21H23NO3Purity:98.0%Molecular weight:337.419N-(p-amylcinnamoyl) Anthranilic Acid
CAS:Controlled Product<p>Applications N-(p-amylcinnamoyl) Anthranilic Acid is and inhibitor of phospholipase A2 which blocks the release of arachidonic acid.<br>References Konrad, R.J., et al.: Biochim. Biophys. Acta., 1135, 215 (1992); Simonsson, E., et al.: Diabetes, 47, 1436 (1998)<br></p>Formula:C21H23NO3Color and Shape:NeatMolecular weight:337.41




