CAS 110698-60-7
:(4-AMINOPHENYL)(1-METHYL-1H-IMIDAZOL-2-YL)METHANONE
Description:
(4-Aminophenyl)(1-methyl-1H-imidazol-2-yl)methanone, with the CAS number 110698-60-7, is a chemical compound characterized by its unique structural features. It consists of an aminophenyl group and a methylimidazole moiety, linked through a carbonyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in organic solvents and moderate stability under standard conditions. The presence of the amino group suggests it may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the imidazole ring contributes to its potential biological activity, as imidazole derivatives are often found in pharmaceuticals and agrochemicals. The compound may also exhibit fluorescence or other optical properties, depending on its environment. Overall, its structural characteristics suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C11H11N3O
InChI:InChI=1/C11H11N3O/c1-14-7-6-13-11(14)10(15)8-2-4-9(12)5-3-8/h2-7H,12H2,1H3
SMILES:Cn1ccnc1C(=O)c1ccc(cc1)N
Synonyms:- methanone, (4-aminophenyl)(1-methyl-1H-imidazol-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.