CAS 110704-43-3

5-(CHLOROMETHYL)-3-(2-METHOXYPHENYL)-1,2,4-OXADIAZOLE

Description:

5-(Chloromethyl)-3-(2-methoxyphenyl)-1,2,4-oxadiazole is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. The presence of a chloromethyl group enhances its reactivity, making it a potential intermediate in organic synthesis. The methoxyphenyl substituent contributes to its aromatic character, which can influence its electronic properties and solubility. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structure allows for various applications, including use as a building block in the synthesis of more complex molecules. Additionally, the compound's stability and reactivity can be influenced by the substituents on the oxadiazole ring, which can affect its interactions in chemical reactions. Overall, 5-(chloromethyl)-3-(2-methoxyphenyl)-1,2,4-oxadiazole represents a versatile structure in the field of organic chemistry.

Formula: C₁₀H₉ClN₂O₂

InChI: InChI=1/C10H9ClN2O2/c1-14-8-5-3-2-4-7(8)10-12-9(6-11)15-13-10/h2-5H,6H2,1H3

SMILES: COc1ccccc1c1nc(CCl)on1

5-(Chloromethyl)-3-(2-methoxyphenyl)-1,2,4-oxadiazole

CAS: 110704-43-3

Versatile small molecule scaffold

Formula: C₁₀H₉ClN₂O₂

Purity: Min. 95%

Molecular weight: 224.64 g/mol

Ref: 3D-KEA70443