CAS 110704-47-7
:5-Chloromethyl-3-(2-trifluoromethylphenyl)-[1,2,4]oxadiazole
Description:
5-Chloromethyl-3-(2-trifluoromethylphenyl)-[1,2,4]oxadiazole is a heterocyclic organic compound characterized by the presence of an oxadiazole ring, which is a five-membered ring containing two nitrogen atoms and three carbon atoms. The compound features a chloromethyl group, which enhances its reactivity and potential for further chemical modifications. The trifluoromethylphenyl substituent contributes to its unique electronic properties, making it of interest in various applications, including pharmaceuticals and agrochemicals. The presence of fluorine atoms typically increases lipophilicity and metabolic stability, which can influence the compound's biological activity. Additionally, the oxadiazole moiety is known for its potential use in materials science, particularly in the development of luminescent and electronic materials. Overall, this compound's structural characteristics suggest it may exhibit interesting chemical behavior and potential utility in diverse fields, including medicinal chemistry and material science.
Formula:C10H6ClF3N2O
InChI:InChI=1/C10H6ClF3N2O/c11-5-8-15-9(16-17-8)6-3-1-2-4-7(6)10(12,13)14/h1-4H,5H2
SMILES:c1ccc(c(c1)c1nc(CCl)on1)C(F)(F)F
Synonyms:- 5-Chloromethyl-3-(2-trifluoromethyl-phenyl)-[1,2,4]oxadiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.