CymitQuimica logo

CAS 1107064-34-5

:

B-[4-(3,3-Diethoxypropoxy)phenyl]boronic acid

Description:
B-[4-(3,3-Diethoxypropoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a 3,3-diethoxypropoxy group, which enhances its solubility and reactivity. Boronic acids are typically polar and can participate in Suzuki coupling reactions, a key method for forming carbon-carbon bonds in organic synthesis. This specific compound may exhibit properties such as moderate to high solubility in organic solvents, and its reactivity can be influenced by the steric and electronic effects of the substituents on the phenyl ring. Additionally, the presence of the boron atom allows for potential applications in materials science, particularly in the development of sensors and drug delivery systems. Overall, B-[4-(3,3-Diethoxypropoxy)phenyl]boronic acid is a versatile compound with significant implications in both research and industrial applications.
Formula:C13H21BO5
InChI:InChI=1S/C13H21BO5/c1-3-17-13(18-4-2)9-10-19-12-7-5-11(6-8-12)14(15)16/h5-8,13,15-16H,3-4,9-10H2,1-2H3
InChI key:InChIKey=ZVPILWNKTDFIQE-UHFFFAOYSA-N
SMILES:O(CCC(OCC)OCC)C1=CC=C(B(O)O)C=C1
Synonyms:
  • Boronic acid, B-[4-(3,3-diethoxypropoxy)phenyl]-
  • B-[4-(3,3-Diethoxypropoxy)phenyl]boronic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.