CAS 110732-06-4
:3-chloro-4,5-diethoxybenzaldehyde
Description:
3-Chloro-4,5-diethoxybenzaldehyde is an organic compound characterized by its aromatic structure, featuring a benzaldehyde functional group along with two ethoxy substituents and a chlorine atom. The presence of the aldehyde group (-CHO) indicates that it is a reactive compound, capable of participating in various chemical reactions, such as nucleophilic additions. The ethoxy groups (-OCH2CH3) enhance its solubility in organic solvents and may influence its reactivity and stability. The chlorine atom introduces additional polarity and can affect the compound's electronic properties, potentially making it a useful intermediate in organic synthesis. This compound is typically utilized in the synthesis of more complex organic molecules and may have applications in pharmaceuticals or agrochemicals. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Safety data should be consulted, as halogenated compounds can pose health risks and environmental concerns.
Formula:C11H13ClO3
InChI:InChI=1/C11H13ClO3/c1-3-14-10-6-8(7-13)5-9(12)11(10)15-4-2/h5-7H,3-4H2,1-2H3
SMILES:CCOc1cc(cc(c1OCC)Cl)C=O
Synonyms:- Benzaldehyde, 3-Chloro-4,5-Diethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
