CAS 11075-15-3: 3-hydroxy-2-[3-(4-hydroxyphenyl)propanoyl]-5-methoxyphenyl alpha-L-talopyranoside
Description:3-Hydroxy-2-[3-(4-hydroxyphenyl)propanoyl]-5-methoxyphenyl alpha-L-talopyranoside, with the CAS number 11075-15-3, is a complex organic compound characterized by its glycosidic structure, which includes a sugar moiety (alpha-L-talopyranoside) linked to a phenolic compound. This substance features multiple functional groups, including hydroxyl (-OH) and methoxy (-OCH3) groups, contributing to its potential biological activity and solubility properties. The presence of the 4-hydroxyphenyl group suggests possible antioxidant properties, while the methoxy group may influence its reactivity and interaction with biological systems. The compound's structural complexity indicates potential applications in pharmaceuticals or as a biochemical probe, although specific biological activities would require further investigation. Its stability, solubility, and reactivity would depend on environmental conditions such as pH and temperature. Overall, this compound exemplifies the intricate relationship between structure and function in organic chemistry, particularly in the context of natural product chemistry and medicinal applications.
Formula:C22H26O10
InChI:InChI=1/C22H26O10/c1-30-13-8-15(26)18(14(25)7-4-11-2-5-12(24)6-3-11)16(9-13)31-22-21(29)20(28)19(27)17(10-23)32-22/h2-3,5-6,8-9,17,19-24,26-29H,4,7,10H2,1H3/t17-,19+,20+,21+,22+/m0/s1
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Asebotin REF: TM-TN3461CAS: 11075-15-3 | 98% | 200.00 € | Tue 04 Mar 25 |
![]() | Asebotin REF: BP-SBP04162CAS: 11075-15-3 | 95%~99% | To inquire | Tue 04 Mar 25 |
![]() | Asebotin REF: 3D-XA161659CAS: 11075-15-3 | Min. 95% | 348.00 €~1,721.00 € | Mon 14 Apr 25 |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Asebotin
Ref: TM-TN3461
1mg | 200.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Asebotin
Ref: 3D-XA161659
1mg | 348.00 € | ||
5mg | 1,076.00 € | ||
10mg | 1,721.00 € |