CAS 1107579-37-2
:(3-Methoxyphenyl)boronic acid
Description:
(3-Methoxyphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a methoxy-substituted phenyl ring. This compound typically exhibits a white to off-white crystalline solid form and is soluble in polar organic solvents such as methanol and ethanol, while being less soluble in non-polar solvents. The boronic acid group (-B(OH)2) is known for its ability to form reversible covalent bonds with diols, making it valuable in various applications, including organic synthesis and medicinal chemistry. The methoxy group (-OCH3) enhances the compound's reactivity and solubility, influencing its interactions in chemical reactions. Additionally, (3-Methoxyphenyl)boronic acid can serve as a building block in the synthesis of complex organic molecules and is often utilized in Suzuki-Miyaura cross-coupling reactions, which are pivotal in the formation of carbon-carbon bonds. Its unique properties make it a useful reagent in the development of pharmaceuticals and agrochemicals.
Formula:C7H9BO3
InChI:InChI=1S/C7H9BO3/c1-11-7-4-2-3-6(5-7)8(9)10/h2-5,9-10H,1H3
InChI key:InChIKey=NLLGFYPSWCMUIV-UHFFFAOYSA-N
SMILES:B(O)(O)C1=CC(OC)=CC=C1
Synonyms:- B-(3-Methoxyphenyl)boronic acid
- Benzeneboronic acid, m-methoxy-
- m-Anisylboronic acid
- Boronic acid, B-(3-methoxyphenyl)-
- Boronic acid, (3-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
