CAS 11076-29-2
:Streptomyces pepsin inhibitor
Description:
Streptomyces pepsin inhibitor, with the CAS number 11076-29-2, is a proteinaceous compound derived from the bacterium Streptomyces. This inhibitor is known for its ability to inhibit pepsin, an enzyme that plays a crucial role in the digestion of proteins in the stomach. The structure of the Streptomyces pepsin inhibitor typically consists of a polypeptide chain that folds into a specific three-dimensional conformation, allowing it to effectively bind to the active site of pepsin and prevent substrate access. This characteristic makes it valuable in biochemical research and potential therapeutic applications, particularly in studying protein digestion and enzyme regulation. The inhibitor is often used in laboratory settings to explore enzyme kinetics and the mechanisms of enzyme inhibition. Additionally, its stability under various pH and temperature conditions can vary, which is important for its application in different experimental contexts. Overall, Streptomyces pepsin inhibitor serves as a significant tool in the field of enzymology and protein chemistry.
Formula:C31H57N5O9
InChI:InChI=1/C31H57N5O9/c1-15(2)11-21(35-30(44)28(18(7)8)36-31(45)27(17(5)6)33-20(10)37)23(38)13-25(40)32-19(9)29(43)34-22(12-16(3)4)24(39)14-26(41)42/h15-19,21-24,27-28,38-39H,11-14H2,1-10H3,(H,32,40)(H,33,37)(H,34,43)(H,35,44)(H,36,45)(H,41,42)/t19-,21-,22-,23-,24-,27-,28-/m0/s1
SMILES:CC(C)C[C@@H]([C@H](CC(=N[C@@H](C)C(=N[C@@H](CC(C)C)[C@H](CC(=O)O)O)O)O)O)N=C([C@H](C(C)C)N=C([C@H](C(C)C)N=C(C)O)O)O
Synonyms:- Ac-Pepstatin
- Ac-Val-val-4-amino-3-hydroxy-6-Me-heptanoyl-ala-4-amino-3-hydroxyl-6-Me-heptanoic acid
- Acetylvalylvalyl-4-amino-3-hydroxy-6-methylheptanoylalanyl-4-amino-3-hydroxyl-6-methylheptanoic acid
- L-Valinamide, N-acetyl-L-valyl-N-(4-((2-((1-(2-carboxy-1-hydroxyethyl)-3-methylbutyl)amino)-1-methyl-2-oxoethyl)amino)-2-hydroxy-1-(2-methylpropyl)-4-oxobutyl)-, (1S-(1R*,2R*,4(R*(R*(R*)))))-
- N-acetyl-L-valyl-N-[(3S,4S)-4-amino-3-hydroxy-6-methylheptanoyl]-N-[(2S)-2-({1-[(1S)-2-carboxy-1-hydroxyethyl]-3-methylbutyl}amino)propanoyl]-L-valinamide
- N-acetyl-L-valyl-N-[(1S,2S)-4-{[(1S)-2-({(1S)-1-[(1S)-2-carboxy-1-hydroxyethyl]-3-methylbutyl}amino)-1-methyl-2-oxoethyl]amino}-2-hydroxy-1-(2-methylpropyl)-4-oxobutyl]-L-valinamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Acetyl-pepstatin
CAS:<p>Streptomyces pepsin inhibitor is used as a pepsin inhibitor.</p>Formula:C31H57N5O9Color and Shape:SolidMolecular weight:643.81Acetyl-pepstatin
CAS:Acetyl-pepstatin is a potent protease inhibitor, which is synthesized from a naturally occurring peptide source. Its primary mode of action involves the inhibition of aspartic proteases, a class of enzymes responsible for protein digestion and processing within biological systems. By specifically targeting these enzymes, Acetyl-pepstatin effectively halts the hydrolytic activity, which makes it an invaluable tool in the study of protease function and the regulation of proteolytic pathways.Formula:C31H57N5O9Purity:Min. 95%Molecular weight:643.8 g/mol

