CymitQuimica logo

CAS 1107627-18-8

:

3-(3,4-Dimethoxyphenyl)azetidine

Description:
3-(3,4-Dimethoxyphenyl)azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The presence of the 3,4-dimethoxyphenyl group indicates that the compound has two methoxy (-OCH3) substituents on a phenyl ring, which can influence its solubility, reactivity, and biological activity. The methoxy groups are electron-donating, potentially enhancing the compound's stability and reactivity in certain chemical environments. This compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Its molecular interactions can be influenced by the steric and electronic effects of the substituents, which may affect its binding affinity to biological targets. Additionally, the azetidine ring can participate in various chemical reactions, making it a versatile scaffold in organic synthesis. Overall, 3-(3,4-Dimethoxyphenyl)azetidine represents a unique structure with potential applications in drug development and organic chemistry.
Formula:C11H15NO2
InChI:InChI=1S/C11H15NO2/c1-13-10-4-3-8(5-11(10)14-2)9-6-12-7-9/h3-5,9,12H,6-7H2,1-2H3
InChI key:InChIKey=HGIIXEHAYXWIEL-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=CC1OC)C2CNC2
Synonyms:
  • 3-(3,4-Dimethoxyphenyl)azetidine
  • Azetidine, 3-(3,4-dimethoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.