CAS 1107632-55-2

Benzenemethanamine, 4-(1H-1,2,3-triazol-1-yl)-, hydrochloride (1:1)

Description:

Benzenemethanamine, 4-(1H-1,2,3-triazol-1-yl)-, hydrochloride (1:1), commonly referred to as a triazole derivative, is a chemical compound characterized by its aromatic amine structure combined with a triazole ring. This compound typically exhibits properties associated with both amines and heterocyclic compounds, including potential biological activity. The presence of the triazole moiety may impart unique pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of antimicrobial or antifungal agents. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its bioavailability. The compound's stability, reactivity, and interaction with biological systems can be influenced by the functional groups present, making it a subject of study in various chemical and pharmaceutical applications. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure.

Formula: C₉H₁₀N₄·ClH

InChI: InChI=1S/C9H10N4.ClH/c10-7-8-1-3-9(4-2-8)13-6-5-11-12-13;/h1-6H,7,10H2;1H

InChI key: InChIKey=UNEHYEMYUJFBBU-UHFFFAOYSA-N

SMILES: C(N)C1=CC=C(C=C1)N2C=CN=N2.Cl

Synonyms:

• Benzenemethanamine, 4-(1H-1,2,3-triazol-1-yl)-, hydrochloride (1:1)

(4-(1H-1,2,3-Triazol-1-yl)phenyl)methanamine hydrochloride

CAS: 1107632-55-2

Formula: C₉H₁₁ClN₄

Purity: 95%

Molecular weight: 210.6634

Ref: IN-DA019EXW

(4-(1H-1,2,3-TRIAZOL-1-YL)PHENYL)METHANAMINE HCL

CAS: 1107632-55-2

Purity: 95.0%

Molecular weight: 210.6699981689453

Ref: 10-F527351

(-4(1H-1,2,3-Triazol-1-Yl)Phenyl)Methanamine Hydrochloride

CAS: 1107632-55-2

Versatile small molecule scaffold

Formula: C₉H₁₁ClN₄

Purity: Min. 95%

Molecular weight: 210.66 g/mol

Ref: 3D-HUB63255