CAS 1107633-38-4

Benzenemethanamine, 4-(1H-1,2,4-triazol-1-yl)-, hydrochloride (1:1)

Description:

Benzenemethanamine, 4-(1H-1,2,4-triazol-1-yl)-, hydrochloride (1:1), commonly referred to as a triazole derivative, is a chemical compound characterized by its aromatic amine structure combined with a triazole ring. This compound typically exhibits properties associated with both amines and heterocyclic compounds, including potential basicity due to the amine group and the presence of nitrogen atoms in the triazole ring, which can participate in hydrogen bonding. As a hydrochloride salt, it is usually more soluble in water compared to its free base form, enhancing its bioavailability in pharmaceutical applications. The compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of antifungal or antimicrobial agents. Its molecular structure allows for various interactions with biological targets, which can be explored in drug design. Safety and handling precautions are essential, as with many amines and heterocycles, due to potential toxicity and reactivity.

Formula: C₉H₁₀N₄·ClH

InChI: InChI=1S/C9H10N4.ClH/c10-5-8-1-3-9(4-2-8)13-7-11-6-12-13;/h1-4,6-7H,5,10H2;1H

InChI key: InChIKey=XAVRTXPEJQCVOJ-UHFFFAOYSA-N

SMILES: C(N)C1=CC=C(C=C1)N2C=NC=N2.Cl

Synonyms:

• [4-(1H-1,2,4-Triazol-1-yl)phenyl]methanamine hydrochloride
• Benzenemethanamine, 4-(1H-1,2,4-triazol-1-yl)-, hydrochloride (1:1)

[4-(1H-1,2,4-triazol-1-yl)benzyl]amine hydrochloride

CAS: 1107633-38-4

Formula: C₉H₁₁ClN₄

Purity: 95.0%

Molecular weight: 210.67

Ref: 10-F359227