CAS 110766-85-3

8-Bromo-2,3-dihydro-1,5-benzothiazepin-4(5H)-one

Description:

8-Bromo-2,3-dihydro-1,5-benzothiazepin-4(5H)-one is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both a benzothiazepine and a bromine substituent. This compound features a fused benzene and thiazepine ring system, contributing to its potential biological activity. The presence of the bromine atom enhances its reactivity and may influence its pharmacological properties. Typically, compounds of this class are studied for their potential applications in medicinal chemistry, particularly as they may exhibit various biological activities, including antimicrobial, anti-inflammatory, or anticancer properties. The molecular structure includes a carbonyl group, which is indicative of its classification as a ketone, and the dihydro form suggests the presence of saturated carbon atoms within the ring system. As with many heterocycles, the electronic properties and steric factors of 8-Bromo-2,3-dihydro-1,5-benzothiazepin-4(5H)-one can significantly affect its reactivity and interactions with biological targets, making it a compound of interest in drug development and synthetic chemistry.

Formula: C₉H₈BrNOS

InChI: InChI=1S/C9H8BrNOS/c10-6-1-2-7-8(5-6)13-4-3-9(12)11-7/h1-2,5H,3-4H2,(H,11,12)

InChI key: InChIKey=HYLLZSFHZFBYOV-UHFFFAOYSA-N

SMILES: BrC=1C=C2C(=CC1)NC(=O)CCS2

Synonyms:

• 1,5-Benzothiazepin-4(5H)-one, 8-bromo-2,3-dihydro-
• 8-Bromo-2,3-dihydro-1,5-benzothiazepin-4(5H)-one