CymitQuimica logo

CAS 1107694-74-5

:

2-Chloro-5-iodo-4(3H)-quinazolinone

Description:
2-Chloro-5-iodo-4(3H)-quinazolinone is a heterocyclic organic compound characterized by its quinazolinone structure, which consists of a fused benzene and pyrimidine ring system. The presence of chlorine and iodine substituents at the 2 and 5 positions, respectively, contributes to its unique chemical properties and reactivity. This compound typically exhibits moderate to high solubility in organic solvents, while its solubility in water may be limited due to its hydrophobic nature. The halogen substituents can influence its biological activity, making it of interest in medicinal chemistry for potential pharmaceutical applications. Additionally, the compound may exhibit various functional properties, such as fluorescence or photostability, depending on its molecular environment. Its synthesis often involves multi-step reactions, and it can be analyzed using techniques like NMR spectroscopy, mass spectrometry, and chromatography. Overall, 2-Chloro-5-iodo-4(3H)-quinazolinone represents a valuable compound in research, particularly in the fields of drug discovery and development.
Formula:C8H4ClIN2O
InChI:InChI=1S/C8H4ClIN2O/c9-8-11-5-3-1-2-4(10)6(5)7(13)12-8/h1-3H,(H,11,12,13)
InChI key:InChIKey=XYLBHVYPDJQFJS-UHFFFAOYSA-N
SMILES:O=C1C=2C(NC(Cl)=N1)=CC=CC2I
Synonyms:
  • 2-Chloro-5-iodo-4(3H)-quinazolinone
  • 4(3H)-Quinazolinone, 2-chloro-5-iodo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.