CymitQuimica logo

CAS 1107694-75-6

:

2-Chloro-8-iodo-4(3H)-quinazolinone

Description:
2-Chloro-8-iodo-4(3H)-quinazolinone is a heterocyclic compound characterized by its quinazolinone core, which features a fused bicyclic structure containing both benzene and pyrimidine rings. The presence of chlorine and iodine substituents at the 2 and 8 positions, respectively, significantly influences its chemical reactivity and biological activity. This compound typically exhibits moderate to high solubility in organic solvents, while its solubility in water may vary depending on pH and other conditions. The halogen substituents can enhance its potential as a pharmacophore in medicinal chemistry, making it a candidate for various biological applications, including antimicrobial and anticancer activities. Additionally, the compound may participate in nucleophilic substitution reactions due to the presence of the halogens, and its structure allows for potential interactions with biological targets. Overall, 2-Chloro-8-iodo-4(3H)-quinazolinone is of interest in both synthetic and medicinal chemistry due to its unique structural features and potential therapeutic applications.
Formula:C8H4ClIN2O
InChI:InChI=1S/C8H4ClIN2O/c9-8-11-6-4(7(13)12-8)2-1-3-5(6)10/h1-3H,(H,11,12,13)
InChI key:InChIKey=CHJFBURJONTQCQ-UHFFFAOYSA-N
SMILES:O=C1C=2C(NC(Cl)=N1)=C(I)C=CC2
Synonyms:
  • 2-Chloro-8-iodo-4(3H)-quinazolinone
  • 4(3H)-Quinazolinone, 2-chloro-8-iodo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.