CymitQuimica logo

CAS 1107694-89-2

:

2-Chloro-6-(trifluoromethoxy)-4-quinazolinamine

Description:
2-Chloro-6-(trifluoromethoxy)-4-quinazolinamine is a chemical compound characterized by its quinazolinamine core, which is a bicyclic structure containing both a benzene and a pyrimidine ring. The presence of a chloro group at the 2-position and a trifluoromethoxy group at the 6-position significantly influences its chemical properties and reactivity. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents, which can be attributed to the polar trifluoromethoxy group. The trifluoromethoxy moiety enhances the compound's lipophilicity and may contribute to its biological activity, making it of interest in medicinal chemistry. Additionally, the chlorine atom can participate in various chemical reactions, such as nucleophilic substitution. Overall, 2-Chloro-6-(trifluoromethoxy)-4-quinazolinamine is notable for its potential applications in pharmaceuticals, particularly in the development of targeted therapies due to its unique structural features.
Formula:C9H5ClF3N3O
InChI:InChI=1S/C9H5ClF3N3O/c10-8-15-6-2-1-4(17-9(11,12)13)3-5(6)7(14)16-8/h1-3H,(H2,14,15,16)
InChI key:InChIKey=ODTFSGOAFFOWCH-UHFFFAOYSA-N
SMILES:NC=1C2=C(C=CC(OC(F)(F)F)=C2)N=C(Cl)N1
Synonyms:
  • 4-Quinazolinamine, 2-chloro-6-(trifluoromethoxy)-
  • 2-Chloro-6-(trifluoromethoxy)-4-quinazolinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.