CAS 110802-16-9

7-chloro-2-phenylquinolin-4(1H)-one

Description:

7-Chloro-2-phenylquinolin-4(1H)-one is a chemical compound characterized by its quinoline structure, which features a fused bicyclic system containing a nitrogen atom. This compound exhibits a chloro substituent at the 7-position and a phenyl group at the 2-position of the quinoline ring. The presence of the carbonyl group at the 4-position contributes to its classification as a quinolinone. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The compound is of interest in medicinal chemistry due to its potential biological activities, including antimicrobial and anticancer properties. Its molecular structure allows for various interactions with biological targets, making it a subject of research in drug development. Additionally, the presence of the chlorine atom may influence its reactivity and pharmacokinetic properties. As with many organic compounds, safety data should be consulted before handling, as it may pose health risks or environmental hazards.

Formula: C₁₅H₁₀ClNO

InChI: InChI=1/C15H10ClNO/c16-11-6-7-12-14(8-11)17-13(9-15(12)18)10-4-2-1-3-5-10/h1-9H,(H,17,18)

SMILES: c1ccc(cc1)c1cc(=O)c2ccc(cc2[nH]1)Cl

Synonyms:

• 4-Quinolinol, 7-Chloro-2-Phenyl-
• 7-Chloro-2-phenylquinolin-4-ol