CAS 110811-32-0

4-Methyl 1H-indole-3,4-dicarboxylate

Description:

4-Methyl 1H-indole-3,4-dicarboxylate is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular derivative features two carboxylate groups at the 3 and 4 positions of the indole ring, along with a methyl group at the 4 position. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and organic synthesis. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on the specific conditions and purity of the sample. As with many indole derivatives, it may also exhibit interesting biological activities, warranting further investigation in drug development and related research.

Formula: C₁₁H₉NO₄

InChI: InChI=1S/C11H9NO4/c1-16-11(15)6-3-2-4-8-9(6)7(5-12-8)10(13)14/h2-5,12H,1H3,(H,13,14)

InChI key: InChIKey=SFSQGVCYTSTWKX-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C2C(NC=C2C(O)=O)=CC=C1

Synonyms:

• 4-Methyl 1H-indole-3,4-dicarboxylate
• 1H-Indole-3,4-dicarboxylic acid, 4-methyl ester