CymitQuimica logo

CAS 110821-37-9

:

Ethyl 5-chloro-1-(4-nitrophenyl)-1H-pyrazole-4-carboxylate

Description:
Ethyl 5-chloro-1-(4-nitrophenyl)-1H-pyrazole-4-carboxylate is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a chloro substituent at the 5-position and a 4-nitrophenyl group at the 1-position, contributing to its unique chemical properties and potential biological activity. The ethyl ester functional group at the 4-carboxylate position enhances its solubility in organic solvents and may influence its reactivity. The presence of the nitro group typically indicates potential for electrophilic reactions, while the chloro group can participate in nucleophilic substitution reactions. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in agrochemicals or pharmaceuticals, particularly in the development of new therapeutic agents. As with many pyrazole derivatives, it may also possess anti-inflammatory or analgesic properties, although specific biological activities would require further investigation.
Formula:C12H10ClN3O4
InChI:InChI=1S/C12H10ClN3O4/c1-2-20-12(17)10-7-14-15(11(10)13)8-3-5-9(6-4-8)16(18)19/h3-7H,2H2,1H3
InChI key:InChIKey=DFONJFIUUOSJLQ-UHFFFAOYSA-N
SMILES:ClC=1N(N=CC1C(OCC)=O)C2=CC=C(N(=O)=O)C=C2
Synonyms:
  • 1H-Pyrazole-4-carboxylic acid, 5-chloro-1-(4-nitrophenyl)-, ethyl ester
  • Ethyl 5-chloro-1-(4-nitrophenyl)-1H-pyrazole-4-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.