CAS 110821-39-1

ETHYL 5-BROMO-1-(3-CHLOROPHENYL)-1H-PYRAZOLE-4-CARBOXYLATE

Description:

Ethyl 5-bromo-1-(3-chlorophenyl)-1H-pyrazole-4-carboxylate, with the CAS number 110821-39-1, is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a bromine atom at the 5-position and a chlorophenyl group at the 1-position contributes to its unique reactivity and potential biological activity. The ethyl ester functional group at the 4-position enhances its solubility in organic solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. This compound may exhibit interesting pharmacological properties, potentially acting as an intermediate in the synthesis of more complex molecules or as a lead compound in drug discovery. Its structural features suggest that it could interact with biological targets, although specific biological activities would require further investigation. As with many halogenated compounds, it is essential to handle it with care due to potential toxicity and environmental impact.

Formula: C₁₂H₁₀BrClN₂O₂

InChI: InChI=1/C12H10BrClN2O2/c1-2-18-12(17)10-7-15-16(11(10)13)9-5-3-4-8(14)6-9/h3-7H,2H2,1H3

Ethyl 5-bromo-1-(3-chlorophenyl)-1H-pyrazole-4-carboxylate

CAS: 110821-39-1

Formula: C₁₂H₁₀BrClN₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 329.5770

Ref: IN-DA007C2S

Ethyl 5-bromo-1-(3-chlorophenyl)-1H-pyrazole-4-carboxylate

CAS: 110821-39-1

Ethyl 5-bromo-1-(3-chlorophenyl)-1H-pyrazole-4-carboxylate

Purity: 98%

Molecular weight: 329.58g/mol

Ref: 54-OR83953

Ethyl 5-bromo-1-(3-chlorophenyl)-1H-pyrazole-4-carboxylate

CAS: 110821-39-1

Purity: 98%

Molecular weight: 329.5799866

Ref: 10-F718319