CAS 110841-68-4

N-(3-methoxybenzyl)prop-2-en-1-amine

Description:

N-(3-methoxybenzyl)prop-2-en-1-amine, with the CAS number 110841-68-4, is an organic compound characterized by its alkenyl amine structure. It features a prop-2-en-1-amine backbone, which includes a double bond between the second and third carbon atoms, contributing to its reactivity. The presence of the 3-methoxybenzyl group enhances its lipophilicity and may influence its biological activity. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can affect its solubility in various solvents. Additionally, the methoxy group can participate in electronic effects, potentially impacting the compound's reactivity and interaction with biological targets. Due to its structural features, N-(3-methoxybenzyl)prop-2-en-1-amine may be of interest in medicinal chemistry and organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. However, specific applications and biological activities would require further investigation and research.

Formula: C₁₁H₁₅NO

InChI: InChI=1/C11H15NO/c1-3-7-12-9-10-5-4-6-11(8-10)13-2/h3-6,8,12H,1,7,9H2,2H3

SMILES: C=CCNCc1cccc(c1)OC

N-(3-methoxybenzyl)-2-propen-1-amine hydrochloride

CAS: 110841-68-4

Formula: C₁₁H₁₆ClNO

Purity: 95.0%

Molecular weight: 213.71

Ref: 10-F361758

N-[(3-Methoxyphenyl)methyl]prop-2-en-1-amine

CAS: 110841-68-4

Versatile small molecule scaffold

Formula: C₁₁H₁₅NO

Purity: Min. 95%

Molecular weight: 177.24 g/mol

Ref: 3D-KEA84168